banthine chloride

🙚 Home 🙚 Tables for Chemistry 🙘 Compound classes 🙘

banthine chloride
Formula:C21H26ClNO3; 375.90 g/mol
InChiKey:WPWZGEGFOHKFHG-UHFFFAOYSA-M
SMILES:[Cl-].CC[N+](C)(CC)CCOC(=O)C1c2ccccc2Oc3ccccc13
Molecular structure of banthine chloride
Toxicology (LD50):47.0 mg/Kg (mouse, ip); 333 mg/Kg(mouse, or); 1 360 mg/Kg(rat, or)

Isomers

banthine chloride
Molecular structure of banthine chloride
3-chloro-4-(phenylmethoxy)benzeneacetic acid cyclohexanamine
Molecular structure of 3-chloro-4-(phenylmethoxy)benzeneacetic acid cyclohexanamine
(1-methylpiperidin-2-yl)methyl 2-hydroxy-2,2-diphenylacetate hydrochloride
Molecular structure of (1-methylpiperidin-2-yl)methyl 2-hydroxy-2,2-diphenylacetate hydrochloride
propylbenzilylcholine mustard
Molecular structure of propylbenzilylcholine mustard
  ::     ::   Zla Mavka